Benzyl 2,3,4-tri-O-acetyl-4-nitromethyl-b-D-arabinopyranose
Benzyl 2,3,4-tri-O-acetyl-4-nitromethyl-b-D-arabinopyranose, an extensively researched chemical compound, exhibits immense promise in the realm of biomedical research. Its versatility extends to potential application in the development of drugs targeting a gamut of afflictions, spanning from cancer to infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383173-65-7 |
| Pricing | Inquire |
| Cas | 383173-65-7 |
| Molecular Weight | 425.39 |
| Molecular Formula | C19H23NO10 |
| Canonical SMILES | CC(=O)OC1C(C(COC1OCC2=CC=CC=C2)(C[N+](=O)[O-])OC(=O)C)OC(=O)C |