2-Amino-6-chloro-3-nitropyridine
2-Amino-6-chloro-3-nitropyridine is a vital compound in the biomedical field, finding extensive application within the pharmaceutical industry. Its role in synthesizing diverse medications tailored to study specific ailments is noteworthy. Its application extends to study oncology, immunology and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27048-04-0 |
| Pricing | Inquire |
| Cas | 27048-04-0 |
| Molecular Weight | 173.56 |
| Molecular Formula | C5H4ClN3O2 |
| Canonical SMILES | C1=CC(=NC(=C1[N+](=O)[O-])N)Cl |