Flavidin
Flavidin is a natural compound isolated from the stems of Vanda coerulea, and it shows potent antioxidant capacity. It can also enhance fluorescent imaging, and it should provide a general insight into how to optimize simultaneously the behavior of the chemical probe and the biomolecule, having wide application in molecular detection.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4856 |
| Pricing | Inquire |
| Cas | 83924-98-5 |
| Molecular Weight | 240.258 |
| Molecular Formula | C15H12O3 |
| Canonical SMILES | C1CC2=CC(=CC3=C2C4=C(CO3)C=C(C=C41)O)O |