2-Aminopurine-9-beta-D-(3',5'-di-O-benzoyl-2'-deoxy-2'-fluoro)arabinoriboside
2-Aminopurine-9-beta-D-(3',5'-di-O-benzoyl-2'-deoxy-2'-fluoro)arabinoriboside is a complex biochemical compound commonly utilized in sophisticated scientific investigations of the enzymatic processes underlying genetic information transformation. This unique substance proffers a promising avenue for the development of novel therapeutics targeting cancer and viral infections. Its intrinsic catalytic properties render it an exceptional substrate for enzymes involved in the crucial fabrication of DNA and RNA molecules.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-63-1 |
| Pricing | Inquire |
| Cas | 2095417-63-1 |
| Molecular Weight | 477.45 |
| Molecular Formula | C24H20FN5O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=NC4=CN=C(N=C43)N)F)OC(=O)C5=CC=CC=C5 |