3-Iodo-1-(2-C-methyl-b-D-ribofuranosyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
3-Iodo-1-(2-C-methyl-b-D-ribofuranosyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine, a notable pharmaceutical compound, plays a vital role in the thriving biomedical industry, serving as a potent remedy against diverse afflictions. Remarkably, this innovation exhibits an intrinsic ability to effectively engage crucial cellular pathways implicated in the advancement of cancer, autoimmune disorders, and viral infections. Its distinctive molecular arrangement empowers precise interaction with specific molecular targets, fueling immense potential for tailored therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 847551-00-2 |
| Pricing | Inquire |
| Cas | 847551-00-2 |
| Molecular Weight | 407.16 |
| Molecular Formula | C11H14IN5O4 |
| Canonical SMILES | CC1(C(C(OC1N2C3=NC=NC(=C3C(=N2)I)N)CO)O)O |