Junceellolide-C
Junceellolide C is a transcription inhibitor of cccDNA. Junceellolide C inhibits HBV DNA replication and significantly decreases the level of supernatant HBV RNA with EC50 values of 5.19, 3.52 μM respectively in HepAD38 cells. Junceellolide C is a potent anti-HBV agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121769-82-2 |
| Pricing | Inquire |
| Cas | 121769-82-2 |
| Molecular Weight | 540.99 |
| Molecular Formula | C26H33ClO10 |
| Canonical SMILES | CC1C(=O)OC2C1(C(C3C(C(CCC34CO4)OC(=O)C)(C(C=CC(=C)C2Cl)OC(=O)C)C)OC(=O)C)O |