N-(p-Amylcinnamoyl)anthranilic acid
N-(p-amylcinnamoyl)anthranilic acid is a TPR channel blocker and phospholipase A2 (PLA2) inhibitor. It blocks the receptor-induced release of arachidonic acid and subsequent signaling cascades in the pancreas and the cardiovascular system.
| Supplier | BOC Sciences |
|---|---|
| Product # | 110683-10-8 |
| Pricing | Inquire |
| Cas | 110683-10-8 |
| Molecular Weight | 337.41 |
| Molecular Formula | C21H23NO3 |
| Canonical SMILES | CCCCCC1=CC=C(C=C1)C=CC(=O)NC2=CC=CC=C2C(=O)O |