7-Methyl-GTP inner salt
m7GTP, the nucleoside triphosphate that has a critical role in RNA synthesis and gene expression regulation, is also attributed with virus fighting capabilities and cancer cell apoptosis induction. With its dual functions as a precursor and modifier in RNA synthesis and as an inhibitor in viral infections, m7GTP shows promise in the treatment of diseases such as cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26554-26-7 |
| Pricing | Inquire |
| Cas | 26554-26-7 |
| Molecular Weight | 537.21 |
| Molecular Formula | C11H18N5O14P3 |
| Canonical SMILES | CN1C=[N+](C2=C1C(=O)NC(=N2)N)C3C(C(C(O3)COP(=O)([O-])OP(=O)(O)OP(=O)(O)O)O)O |