Rutin mono(hydrogen sulfate), monosodium salt
Rutin mono(hydrogen sulfate), monosodium salt is a natural compound renowned for its wide-ranging applicability within the domain of disease research. It remarkably excels in studying chronic venous insufficiency.
| Supplier | BOC Sciences |
|---|---|
| Product # | 108916-86-5 |
| Pricing | Inquire |
| Cas | 108916-86-5 |
| Molecular Weight | 712.56 |
| Molecular Formula | C27H29NaO19S |
| Canonical SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=C(C3=O)C(=CC(=C4)OS(=O)(=O)O)[O-])C5=CC(=C(C=C5)O)O)O)O)O)O)O)O.[Na+] |