L-Cytidine
L-Cytidine is a prominent bioactive compound employed extensively, emerging as a pivotal compound for the genesis of nucleic acids. Exerting a profound influence on cellular metabolism, it assumes a crucial mantle in studying diverse ailments encompassing viral afflictions, malignant neoplasms and conditions affecting the neurologic milieu.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26524-60-7 |
| Pricing | Inquire |
| Cas | 26524-60-7 |
| Molecular Weight | 243.22 |
| Molecular Formula | C9H13N3O5 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |