OTS964
OTS964 is an inhibitor of lymphokine-activated killer T cell-originated protein kinase (TOPK) with IC50 value of 28 nM. OTS964 targets glioma stem cells (GSCs) and inhibits their growth, resulting in shrinkage of the power-law coded GSC populations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1338542-14-5 |
| Pricing | Inquire |
| Cas | 1338542-14-5 |
| Molecular Weight | 392.5 |
| Molecular Formula | C23H24N2O2S |
| Canonical SMILES | CC1=CC(=C(C2=C1NC(=O)C3=C2C=CS3)C4=CC=C(C=C4)C(C)CN(C)C)O |