Eclipse® Quencher Phosphoramidite
Eclipse® Quencher Phosphoramidite is a paramount constituent employed in the fabrication of oligonucleotides, emerges as a pivotal ensemble. Its functions lie in its ability to dampen the fluorescence signal within nucleotide probes, consequently facilitating meticulous identification of distinctive DNA or RNA sequences. It substantiates its worth by contributing to the proficiency of diagnostic assays and molecular biology research, consequently augmenting the detection and scrutiny of assorted maladies and genetic irregularities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 916753-64-5 |
| Pricing | Inquire |
| Cas | 916753-64-5 |
| Molecular Weight | 978.52 |
| Molecular Formula | C52H61CIN7O8P |
| Canonical SMILES | N#CCCOP(OC1CN(C(=O)CCCN(C2=CC=C(N=NC3=CC=C(C=C3Cl)N(=O)=O)C=C2)C)C(COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6)C1)N(C(C)C)C(C)C |