Phenyl 2,3,4,6-tetra-O-acetyl-a-L-thioglucopyranoside
Phenyl 2,3,4,6-tetra-O-acetyl-α-L-thioglucopyranoside is a key compound used in biomedical field research acting as a substrate for enzymatic reactions involved in glycobiology studies. This compound serves as an essential component in the synthesis of carbohydrate-based inhibitors and glycosidase probes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 943226-48-0 |
| Pricing | Inquire |
| Cas | 943226-48-0 |
| Molecular Weight | 440.46 |
| Molecular Formula | C20H24O9S |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)SC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C |