GDP366
GDP366 is a novel small molecule compound which potently and selectively inhibited the expression of both survivin and Op18. GDP366 induces cell growth inhibition, cellular senescence and mitotic catastrophe in human cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 501698-03-9 |
| Pricing | Inquire |
| Cas | 501698-03-9 |
| Molecular Weight | 375.45 |
| Molecular Formula | C20H17N5OS |
| Canonical SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)C3=CSC4=NC=NC(=C34)N |