5'-Deoxy-8,5'-cycloadenosine
5'-Deoxy-8,5'-cycloadenosine, an intriguing nucleoside analog, demonstrates immense potential in the realm of biomedicine. With its profound antitumor effects, this compound emerges as a compelling contender for combating diverse cancer types. By virtue of its distinctive molecular architecture, 5'-Deoxy-8,5'-cycloadenosine showcases remarkable prowess in precisely targeting malignant cells and impeding their proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3415-89-2 |
| Pricing | Inquire |
| Cas | 3415-89-2 |
| Molecular Weight | 249.23 |
| Molecular Formula | C10H11N5O3 |
| Canonical SMILES | C1C2C(C(C(O2)N3C1=NC4=C(N=CN=C43)N)O)O |