Tri(1-naphthyl)phosphine
Tri(1-naphthyl)phosphine is a vital compound extensively used in the biomedical industry. It is primarily employed in the synthesis of various drugs and pharmaceutical compounds. With its unique chemical properties, Tri(1-naphthyl)phosphine contributes to the development of drugs targeting specific diseases and medical conditions, including cancer, inflammation, and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3411-48-1 |
| Pricing | Inquire |
| Cas | 3411-48-1 |
| Molecular Weight | 412.47 |
| Molecular Formula | C30H21P |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2P(C3=CC=CC4=CC=CC=C43)C5=CC=CC6=CC=CC=C65 |