Methimazole thio-b-D-glucuronide
Methimazole thio-b-D-glucuronide, an intriguing derivative of Methimazole renowned for targeting Hyperthyroidism, unveils a fascinating research avenue within the biomedical realm. Unveiling its scientific significance lies in its unique ability to unravel the intricate tapestry of Methimazole's metabolism and pharmacokinetics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39038-19-2 |
| Pricing | Inquire |
| Cas | 39038-19-2 |
| Molecular Weight | 290.29 |
| Molecular Formula | C10H14N2O6S |
| Canonical SMILES | CN1C=CN=C1SC2C(C(C(C(O2)C(=O)O)O)O)O |