4-Bromo-4'-(4-bromophenyl)-3',5',6'-triphenyl-1,1':2',1''-terphenyl
4-Bromo-4'-(4-bromophenyl)-3',5',6'-triphenyl-1,1':2',1''-terphenyl is an incredibly potent compound extensively employed in biomedicine. It exhibits remarkable potential in addressing various ailments encompassing cancer and inflammation. Its extraordinary and distinctive chemical arrangement provides a platform for precise drug administration and regulation of exclusive biological pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | 22932-54-3 |
| Pricing | Inquire |
| Cas | 22932-54-3 |
| Molecular Weight | 692.49 |
| Molecular Formula | C42H28Br2 |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C(=C(C(=C2C3=CC=C(C=C3)Br)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=C(C=C6)Br)C7=CC=CC=C7 |