Gavestinel sodium salt
Gavestinel is a non-competitive antagonist acting at the strychnine-insensitive glycine binding site of the NMDA receptor-channel complex (Kd = 0.8 nM), displaying > 1000-fold selectivity over NMDA, AMPA and kainate binding sites. Gavestinel exhibits a neuroprotective property in animal models of ischaemic stroke.
| Supplier | BOC Sciences |
|---|---|
| Product # | 153436-38-5 |
| Pricing | Inquire |
| Cas | 153436-38-5 |
| Molecular Weight | 397.19 |
| Molecular Formula | C18H11Cl2N2O3Na |
| Canonical SMILES | C1=CC=C(C=C1)NC(=O)C=CC2=C(NC3=CC(=CC(=C32)Cl)Cl)C(=O)[O-].[Na+] |