2- Oxo- 3- (phenylmethoxy) propyl bis(phenylmethyl) Ester Phosphoric Acid
2- Oxo- 3- (phenylmethoxy) propyl bis(phenylmethyl) Ester Phosphoric Acid is an intermediate in the synthesis of Dihydroxyacetone Phosphate Lithium Salt (D450538), which is a metabolic intermediate involved in involved in a wide variety of metabolic pathways including glycolysis and lipid biosynthesis. In plants, Dihydroxyacetone phosphate is involved with the synthesis of vitamin B6.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076445 |
| Pricing | Inquire |
| Cas | 796874-61-8 |
| Molecular Weight | 440.43 |
| Molecular Formula | C24H25O6P |
| Canonical SMILES | C1=CC=C(C=C1)COCC(=O)COP(=O)(OCC2=CC=CC=C2)OCC3=CC=CC=C3 |