9-[2-(Diisopropylphosphino)phenyl]-9H-carbazole
9-[2-(Diisopropylphosphino)phenyl]-9H-carbazole is a versatile compound widely used in the biomedical industry. It plays a crucial role as a key building block in the synthesis of intricate organic molecules and coordination complexes. Its unique structure and reactivity allow for the development of new drugs targeting various diseases, including cancer, neurological disorders, and cardiovascular conditions. With its diverse applications, this product is a valuable tool for advanced biomedical research and drug discovery.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1308652-65-4 |
| Pricing | Inquire |
| Cas | 1308652-65-4 |
| Molecular Weight | 359.44 |
| Molecular Formula | C24H26NP |
| Canonical SMILES | CC(C)P(C1=CC=CC=C1N2C3=CC=CC=C3C4=CC=CC=C42)C(C)C |