2-Naphthyl a-L-fucopyranoside
2-Naphthyl a-L-fucopyranoside is a critical compound extensively used in biomedical research. It serves as a substrate for enzymes like fucosidase and alpha-L-fucosidase, enabling the analysis of their activity. Additionally, this product plays a vital role in studying diseases associated with abnormal fucosylation, such as cancer and congenital disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63503-05-9 |
| Pricing | Inquire |
| Cas | 63503-05-9 |
| Molecular Weight | 290.31 |
| Molecular Formula | C16H18O5 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CC3=CC=CC=C3C=C2)O)O)O |