SNS-314 Mesylate
SNS-314 Mesylate is a potent and selective inhibitor of Aurora A, Aurora B and Aurora C with IC50 of 9 nM, 31 nM, and 3 nM, respectively. It is less potent to Trk A/B, Flt4, Fms, Axl, c-Raf and DDR2. Phase 1.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1146618-41-8 |
| Pricing | Inquire |
| Cas | 1146618-41-8 |
| Molecular Weight | 527.04 |
| Molecular Formula | C18H15ClN6OS2.CH4O3S |
| Canonical SMILES | CS(=O)(=O)O.C1=CC(=CC(=C1)Cl)NC(=O)NC2=NC=C(S2)CCNC3=NC=NC4=C3SC=C4 |