L-Quisqualic acid
L-Quisqualic acid is a glutamate receptor agonist acting at AMPA receptors and mGluR positively linked to phosphoinositide hydrolysis. L-Quisqualic acid was shown to induce a slow K(+)-current response in B6 neurons of Aplysia buccal ganglia. It exhibits neuroprotective property and may be beneficial for prostate cancer therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52809-07-1 |
| Pricing | Inquire |
| Cas | 52809-07-1 |
| Molecular Weight | 189.13 |
| Molecular Formula | C5H7N3O5 |
| Canonical SMILES | C(C(C(=O)O)N)N1C(=O)NC(=O)O1 |