Fumaric acid monoethyl ester magnesium salt
Fumaric acid monoethyl ester magnesium salt (CAS# 83918-60-9) is the salt of Fumaric Acid Monoethyl Ester (F500385), which is an anti-psoriatic fumaric acid ester. Fumaric Acid Monoethyl Ester inhibited thymidine-14C incorporation into DNA by cultured human lymphocytes. Fumaric Acid Monoethyl Ester has been shown to evoke transient increase in intracellular free calcium concentration and inhibit proliferation of human keratinocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83918-60-9 |
| Pricing | Inquire |
| Cas | 83918-60-9 |
| Molecular Weight | 310.54 |
| Molecular Formula | C12H14MgO8 |
| Canonical SMILES | CCOC(=O)C=CC(=O)[O-].CCOC(=O)C=CC(=O)[O-].[Mg+2] |