2,3:5,6-Di-O-isopropylidene-L-gulono-1,4-lactone
2,3:5,6-Di-O-isopropylidene-L-gulono-1,4-lactone is a crucial organic compound widely used in the biomedical industry. This compound plays a significant role in the synthesis of Vitamin C (ascorbic acid), a vital nutrient for humans. It aids in the prevention and treatment of scurvy, a disease caused by Vitamin C deficiency.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7306-64-1 |
| Pricing | Inquire |
| Cas | 7306-64-1 |
| Molecular Weight | 258.27 |
| Molecular Formula | C12H18O6 |
| Canonical SMILES | CC1(OCC(O1)C2C3C(C(=O)O2)OC(O3)(C)C)C |