ML241 HCl
ML241 is identified as a potent and selective inhibitors of p97 ATPase (IC(50)= 100 nM). ML241 inhibits degradation of a p97-dependent but not a p97-independent proteasome substrate in a dual-reporter cell line. ML241 could impair the endoplasmic-reticulum-associated degradation (ERAD) pathway.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2070015-13-1 |
| Pricing | Inquire |
| Cas | 2070015-13-1 |
| Molecular Weight | 408.93 |
| Molecular Formula | C23H25ClN4O |
| Canonical SMILES | [H]Cl.C1(N2C3=CC=CC=C3OCC2)=NC(NCC4=CC=CC=C4)=C5CCCCC5=N1 |