1-Deoxy-1-nitro-D-mannitol
1-Deoxy-1-nitro-D-mannitol is a potent pharmaceutical compound used in the treatment of certain bacterial infections. It exhibits excellent antibiotic properties against various drug-resistant strains due to its unique chemical structure. This product plays a crucial role in biomedical research, contributing to the development of new antibacterial drugs for combating infections caused by specific pathogens.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14199-83-8 |
| Pricing | Inquire |
| Cas | 14199-83-8 |
| Molecular Weight | 211.17 |
| Molecular Formula | C6H13NO7 |
| Canonical SMILES | C(C(C(C(C(CO)O)O)O)O)[N+](=O)[O-] |