2,7-Dichlorodihydrofluorescein diacetate
2,7-Dichlorodihydrofluorescein diacetate is a cell-permeable fluorogenic probe for the detection of reactive oxygen species (ROS) and nitric oxide (NO). It is non-fluorescent but can be oxidized to the highly fluorescent product dichlorofluorescein (DHF). It can be utilized in rapid quantification of ROS in response to oxidative metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4091-99-0 |
| Pricing | Inquire |
| Cas | 4091-99-0 |
| Molecular Weight | 487.3 |
| Molecular Formula | C24H16Cl2O7 |
| Canonical SMILES | CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl |