Mannosylglucosaminide
It is produced by the strain of Str. virginiae var. 4243-MTt1. It's an aminoglycoside antibiotic. It has anti-bacterium, mycobacterium and beer yeast effects. Trehalose does not counteract its antibacterial effect against Mycobacterium 607.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02294 |
| Pricing | Inquire |
| Cas | 14510-04-4 |
| Molecular Weight | 341.31 |
| Molecular Formula | C12H23NO10 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(C(C(C(O2)CO)O)O)O)N)O)O)O |