3, 6- Dibromo- α- [[(4- bromophenyl) amino] methyl] -9H- carbazole- 9- ethanol
3, 6- Dibromo- α- [[(4- bromophenyl) amino] methyl] -9H- carbazole- 9- ethanol acts as a reagent for the synthesis of carbazolyaminopropanosl and other related compounds as pro-neurogenic and anit-depression compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068145 |
| Pricing | Inquire |
| Cas | 328076-93-3 |
| Molecular Weight | 553.08 |
| Molecular Formula | C21H17Br3N2O |
| Canonical SMILES | C1=CC(=CC=C1NCC(CN2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br)O)Br |