PROTAC BRD4 Degrader-13
PROTAC BRD4 Degrader-13, a PROTAC connected by ligands for von Hippel-Lindau and BRD4, can be conjugated with STEAP1 and CLL1 antibodies to degrade the BRD4 protein in PC3 prostate cancer cells, with DC50s of 0.025 and 6.0 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01390 |
| Pricing | Inquire |
| Cas | 2417370-71-7 |
| Molecular Weight | 1492.54 |
| Molecular Formula | C68H85F2N11O17P2S2 |
| Canonical SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CNC(=O)C3CC(CN3C(=O)C(C(C)(C)C)NC(=O)CCCCCCCCCCNC(=O)C4=CC5=C(C=C4CS(=O)(=O)C)C6=CN(C(=O)C7=C6C(=CN7)CN5C8=C(C=C(C=N8)F)F)C)OP(=O)(O)OP(=O)(O)OCCNC(=O)CCCCCN9C(=O)C=CC9=O |