DC41-SMe
DC41SMe, a DC1 derivative, shows cytotoxicity in Ramos, Namalwa, and HL60/s cells with IC50s ranging from 18-25 pM. DC1, a simplified analogue of CC-1065, is an antibody conjugate of cytotoxic DNA alkylators for the targeted treatment of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1354787-71-5 |
| Pricing | Inquire |
| Cas | 1354787-71-5 |
| Molecular Weight | 726.31 |
| Molecular Formula | C38H36ClN5O4S2 |
| Canonical SMILES | O=C(C(N1)=CC2=C1C=CC(NC(CCC(SSC)(C)C)=O)=C2)NC3=CC4=C(NC(C(N5C[C@@H](CCl)C6=C5C=C(O)C7=CC=CC=C67)=O)=C4)C=C3 |