4-Cyclohexylbutyl-b-D-glucopyranoside
4-Cyclohexylbutyl-b-D-glucopyranoside is a valuable compound widely used in the applications of research on various diseases, such as diabetes and cancer. This compound acts as a molecular carrier, facilitating the delivery of drugs targeting these specific conditions. Its unique properties make it an essential tool for drug discovery and development in the field of compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869542-54-1 |
| Pricing | Inquire |
| Cas | 869542-54-1 |
| Molecular Weight | 318.41 |
| Molecular Formula | C16H30O6 |
| Canonical SMILES | C1CCC(CC1)CCCCOC2C(C(C(C(O2)CO)O)O)O |