Benzyl Penicillinate-[d7] Potassium Salt
Benzyl Penicillinate-[d7] Potassium Salt is an isotope form of Benzyl Penicillinate Potassium Salt. Penicillin G potassium is a fast-acting antibiotic, used to treat bacterial infections that affect the blood, heart, lungs, joints, and genital areas.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003433 |
| Pricing | Inquire |
| Cas | 352323-25-2 |
| Molecular Weight | 379.52 |
| Molecular Formula | C16H10D7KN2O4S |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)[O-])C.[K+] |