Venlafaxine EP Impurity E
Venlafaxine EP Impurity E is an impurity of Venlafaxine, which is an antidepressant medication of the serotonin-norepinephrine reuptake inhibitor (SNRI) class used to treat major depressive disorder, generalized anxiety disorder, panic disorder, and social anxiety disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 93413-70-8 |
| Pricing | Inquire |
| Cas | 93413-70-8 |
| Molecular Weight | 275.39 |
| Molecular Formula | C17H25NO2 |
| Canonical SMILES | CN1CC(C2(CCCCC2)OC1)C3=CC=C(C=C3)OC |