DNP-PEG5-NHS ester
DNP-PEG5-NHS ester is a PEG linker containing a DNP moiety and an NHS ester terminal group. DNP is involved in biological applications such as involvement in ion transport across membranes. The NHS ester can react with primary amines to form stable amide bonds. The hydrophilic PEG linker increases the water solubility of the compound in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-1669 |
| Pricing | Inquire |
| Molecular Weight | 572.52 |
| Molecular Formula | C23H32N4O13 |
| Canonical SMILES | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCNC2=CC=C([N+]([O-])=O)C=C2[N+]([O-])=O |