L-Fucose-1-phosphate disodium salt
L-Fucose-1-phosphate disodium salt, a pivotal constituent in biomedical investigation, stands as a fundamental substrate for diverse enzymatic activities implicated in myriad biological phenomena. Its indispensability arises from its pivotal involvement in comprehending and scrutinizing the intricate metabolic pathways of L-fucose, an omnipresent saccharide within mammalian cellular matrices.
| Supplier | BOC Sciences |
|---|---|
| Product # | 374726-44-0 |
| Pricing | Inquire |
| Cas | 374726-44-0 |
| Molecular Weight | 288.10 |
| Molecular Formula | C6H11Na2O8P |
| Canonical SMILES | CC1C(C(C(C(O1)OP(=O)([O-])[O-])O)O)O.[Na+].[Na+] |