3-(2-Cyanoethyl)thymidine
3-(2-Cyanoethyl)thymidine is a highly sought-after compound within the biomedical field, serving as a pivotal precursor for nucleoside research and development. It assumes a vital function in the development of antiviral and anticancer pharmaceuticals. Impressively, it demonstrates commendable efficacy in studying the molecular intricacies of targeted illness manifestations, particularly viral afflictions and distinct malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72718-33-3 |
| Pricing | Inquire |
| Cas | 72718-33-3 |
| Molecular Weight | 295.29 |
| Molecular Formula | C13H17N3O5 |
| Canonical SMILES | CC1=CN(C(=O)N(C1=O)CCC#N)C2CC(C(O2)CO)O |