Diclofenac-[13C6] sodium salt
Diclofenac-[13C6] sodium salt, is the labelled analogue of Diclofenac. Diclofenac is a non-selective COX inhibitor with IC50 of 0.5 μg/ml and 0.5 μg/ml for COX-1 and -2 in intact cells, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001624 |
| Pricing | Inquire |
| Cas | 1261393-73-0 |
| Molecular Weight | 324.09 |
| Molecular Formula | C8[13C]6H10Cl2NNaO2 |
| Canonical SMILES | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+] |