myo-Inositol 1,3,4,5,6-pentaphosphate
myo-Inositol 1,3,4,5,6-pentaphosphate, a paramount eukaryotic cell regulator embeds itself within various cellular processes including insulin signaling, lipids metabolism, and the calcium signaling pathway. As research progresses, its involvement in the pathophysiology of impactful diseases like cancer and cardiovascular disease can no longer be denied. The biomedical industry relies on this compound to study the intricacies of these processes and diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20298-95-7 |
| Pricing | Inquire |
| Cas | 20298-95-7 |
| Molecular Weight | 580.06 |
| Molecular Formula | C6H17O21P5 |
| Canonical SMILES | O=P(O)(O)OC1C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |