L-Tyrosine-(4-hydroxy-[17O])
L-Tyrosine-(4-hydroxy-[17O]) is the isotope form of L-Tyrosine, which is a non-essential amino acid and one of the 22 amino acids used in the synthesis of protein. It is derived from phenylalanine in human body and abundant in high-protein food products.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001015 |
| Pricing | Inquire |
| Molecular Weight | 182.19 |
| Molecular Formula | C9H11NO2[17O] |
| Canonical SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |