Pizotyline-[d3]
Pizotyline-[d3], is the labelled analogue of Pizotyline. Pizotifen is a benzocycloheptene-based drug used as a medicine, primarily as a preventive to reduce the frequency of recurrent migraine headaches. Pizotifen, also called as BC 105, a benzocycloheptathiophene derivative that is a highly selective 5-HT receptor blocking agent both in vivo (on saphenous veins) and in vitro (on saphenous veins and basilar arteries).
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003849 |
| Pricing | Inquire |
| Molecular Weight | 298.46 |
| Molecular Formula | C19H18D3NS |
| Canonical SMILES | CN1CCC(=C2C3=C(CCC4=CC=CC=C42)SC=C3)CC1 |