2'-Deoxy-2'-iodouridine
2'-Deoxy-2'-iodouridine is a vital component in nucleic acid chemistry, utilized in biomedical research for studying RNA and DNA structures. It is particularly crucial in investigating the mechanisms of nucleic acid-protein interactions and drug targeting strategies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4753-03-1 |
| Pricing | Inquire |
| Cas | 4753-03-1 |
| Molecular Weight | 354.10 |
| Molecular Formula | C9H11IN2O5 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)I |