1,6-Anhydro-3,4-O-isopropylidene-b-D-galactopyranose
1,6-Anhydro-3,4-O-isopropylidene-b-D-galactopyranose, a crucial compound in the field of biomedical research, holds immense significance. It plays a pivotal role in the advancement of antiviral medications, specifically in countering the prevalent herpes simplex virus (HSV) infections. The compound showcases remarkable efficacy in impeding viral replication, thereby emerging as a compelling contender for combating HSV and its associated ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52579-97-2 |
| Pricing | Inquire |
| Cas | 52579-97-2 |
| Molecular Weight | 202.20 |
| Molecular Formula | C9H14O5 |
| Canonical SMILES | CC1(OC2C3COC(O3)C(C2O1)O)C |