3-(Trifluoromethyl)-1h-pyrazole-4-boronic acid, pinacol ester
3-(Trifluoromethyl)-1H-pyrazole-4-boronic acid, pinacol ester is a vital compound widely employed in the biomedical industry. This product acts as a potent inhibitor targeting specific enzymes involved in various diseases, including cancer and autoimmune disorders. It exhibits exceptional pharmacological properties, making it an essential component in the development of novel drugs for the treatment of these ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1218790-40-9 |
| Pricing | Inquire |
| Cas | 1218790-40-9 |
| Molecular Weight | 262.0 |
| Molecular Formula | C10H14BF3N2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(NN=C2)C(F)(F)F |