GSK 4716
GSK 4716 is a selective agonist of estrogen-related receptors ERRβ and ERRγ displaying selectivity over ERRα and the classical estrogen receptors. Activation of GSK 4716 regulates mitochondrial activity in skeletal muscle during exercise.
| Supplier | BOC Sciences |
|---|---|
| Product # | 101574-65-6 |
| Pricing | Inquire |
| Cas | 101574-65-6 |
| Molecular Weight | 282.34 |
| Molecular Formula | C17H18N2O2 |
| Canonical SMILES | CC(C)C1=CC=C(C=C1)C=NNC(=O)C2=CC=C(C=C2)O |