N-[5-(Hydroxymethyl)-2-phenyl-1,3-dioxan-5-yl]-carbamic Acid Benzyl Ester
N-[5-(Hydroxymethyl)-2-phenyl-1,3-dioxan-5-yl]-carbamic Acid Benzyl Ester is one of fosfomycin intermediates. Fosfomycin is an antibiotic that exerts a broad spectrum of antibacterial activity. It was produced by certain Streptomyces species.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1125824-87-4 |
| Pricing | Inquire |
| Cas | 1125824-87-4 |
| Molecular Weight | 343.37 |
| Molecular Formula | C19H21NO5 |
| Canonical SMILES | C1C(COC(O1)C2=CC=CC=C2)(CO)NC(=O)OCC3=CC=CC=C3 |