Diosbulbin B
Diosbulbin B, a natural diterpenoid found in the roots of Dioscorea bulbifera, has hepatotoxicity, oral administration of DB for 12 consecutive days can lead to the oxidative stress liver injury in mice;ferulic acid prevents. Diosbulbin B exhibits the activity of anti-tumor and has inhibition of gastric cancer cell line SGC-7901 proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1748 |
| Pricing | Inquire |
| Cas | 20086-06-0 |
| Molecular Weight | 344.4 |
| Molecular Formula | C19H20O6 |
| Canonical SMILES | CC12CC(OC13CC(C4C2CC5CC4C(=O)O5)OC3=O)C6=COC=C6 |