2',3'-cAMP sodium salt
2',3'-cAMP is a positional isomer of 3',5'-cAMP that is produced by organ systems such as rat and mouse kidney and mouse brain through RNA degradation. When injured, organisms could produce 2',3'-cAMP and release it into the extracellular compartment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37063-35-7 |
| Pricing | Inquire |
| Cas | 37063-35-7 |
| Molecular Weight | 351.2 |
| Molecular Formula | C10H11N5NaO6P |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C4C(C(O3)CO)OP(=O)(O4)[O-])N.[Na+] |